Juq-158 Fixed File
| Property | Details | |----------|---------| | | (provisional) 1‑(4‑fluorophenyl)-N‑[2‑(pyridin‑3‑yl)ethyl]pyrrolidine‑3‑carboxamide | | Synonyms | JUQ‑158, “Compound 158”, “Research Chemical JUQ‑158” | | Molecular formula | C₁₈H₂₀FN₃O | | Molecular weight | ≈ 311.37 g mol⁻¹ | | CAS number | Not yet assigned (as of early 2026) | | SMILES | FC1=CC=C(C=C1)C(=O)N(CC2=CN=CC=C2)C3CCCN3 | | Class (proposed) | Aryl‑pyrrolidine‑carboxamide; structurally reminiscent of certain synthetic cannabinoids and designer stimulants. |
: If it's a product or model number, you might find more information by searching directly on search engines or visiting the official website of the manufacturer. JUQ-158
Analyze the impact or relevance of JUQ-158 in its respective field or context. | Property | Details | |----------|---------| | |
"The Future of Space Exploration: How Private Companies Are Revolutionizing the Cosmos" "The Future of Space Exploration: How Private Companies
If you provide more context, I'll be happy to help you fill in the template or write a more specific essay.
High-end visual aesthetics that mimic mainstream Japanese television dramas.
Sources: